CAS 123533-41-5
:2-PHENYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
Description:
2-Phenylimidazo[1,2-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its fused imidazole and pyridine rings, along with a phenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of the carboxylic acid. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the carboxylic acid group suggests it can participate in hydrogen bonding and may influence solubility and reactivity in various solvents. Additionally, the compound's structure allows for potential interactions with biological targets, which could be explored in drug design. Its unique arrangement of atoms contributes to its chemical properties, making it a subject of interest in both synthetic and applied chemistry. As with many heterocycles, it may also exhibit fluorescence or other optical properties, depending on its specific environment and substituents.
Formula:C14H10N2O2
InChI:InChI=1/C14H10N2O2/c17-14(18)13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H,(H,17,18)
SMILES:c1ccc(cc1)c1c(C(=O)O)n2ccccc2n1
Synonyms:- Imidazo[1,2-A]Pyridine-3-Carboxylic Acid, 2-Phenyl-
- 2-Phenyl-Imidazo[1,2-A]Pyridine-3-Carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Phenylimidazo[1,2-a]pyridine-3-carboxylic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C14H10N2O2Purity:98%Molecular weight:238.252-Phenylimidazo[1,2-a]pyridine-3-carboxylic acid
CAS:Formula:C14H10N2O2Purity:98%Molecular weight:238.24142-Phenylimidazo[1,2-a]pyridine-3-carboxylic acid
CAS:2-Phenylimidazo[1,2-a]pyridine-3-carboxylic acidFormula:C14H10N2O2Purity:≥95%Color and Shape: pale brown powder/ crystalsMolecular weight:238.24g/mol


