CAS 1235407-01-8
:1,1-Dimethylethyl 3-hydrazinyl-1-azetidinecarboxylate
Description:
1,1-Dimethylethyl 3-hydrazinyl-1-azetidinecarboxylate is a chemical compound characterized by its unique structural features, including a hydrazine functional group and an azetidine ring. The presence of the 1,1-dimethylethyl group contributes to its steric hindrance, which can influence its reactivity and interaction with other molecules. This compound may exhibit properties typical of azetidine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The hydrazine moiety can participate in various chemical reactions, including those involving nucleophilic attack and formation of hydrazones. Additionally, the carboxylate functional group may impart acidic characteristics, affecting solubility and reactivity in different environments. Overall, the combination of these functional groups suggests that 1,1-Dimethylethyl 3-hydrazinyl-1-azetidinecarboxylate could be a versatile compound with potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation and characterization.
Formula:C8H17N3O2
InChI:InChI=1S/C8H17N3O2/c1-8(2,3)13-7(12)11-4-6(5-11)10-9/h6,10H,4-5,9H2,1-3H3
InChI key:InChIKey=ZVJXIYNLVGSAMP-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(NN)C1
Synonyms:- 1-Azetidinecarboxylic acid, 3-hydrazinyl-, 1,1-dimethylethyl ester
- 1-Boc-3-hydrazinylazetidine
- 1,1-Dimethylethyl 3-hydrazinyl-1-azetidinecarboxylate
- tert-Butyl 3-hydrazineylazetidine-1-carboxylate
- 1-Boc-3-hydrazinoazetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
