CymitQuimica logo

CAS 1235407-03-0

:

2-(4-Pyridazinyl)-4-(trifluoromethyl)phenol

Description:
2-(4-Pyridazinyl)-4-(trifluoromethyl)phenol is a chemical compound characterized by its unique structural features, which include a pyridazine ring and a trifluoromethyl group attached to a phenolic structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the hydroxyl (-OH) group. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. Additionally, the pyridazine moiety may impart specific electronic properties, enhancing its potential as a ligand or in various chemical reactions. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, 2-(4-Pyridazinyl)-4-(trifluoromethyl)phenol is a compound of interest in organic synthesis and medicinal chemistry, with potential applications in drug development and material science.
Formula:C11H7F3N2O
InChI:InChI=1S/C11H7F3N2O/c12-11(13,14)8-1-2-10(17)9(5-8)7-3-4-15-16-6-7/h1-6,17H
InChI key:InChIKey=JZWVBCZDXFAOOV-UHFFFAOYSA-N
SMILES:OC=1C(=CC(C(F)(F)F)=CC1)C=2C=CN=NC2
Synonyms:
  • 2-(4-Pyridazinyl)-4-(trifluoromethyl)phenol
  • Phenol, 2-(4-pyridazinyl)-4-(trifluoromethyl)-
  • 2-(Pyridazin-4-yl)-4-(trifluoromethyl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.