CymitQuimica logo

CAS 1235407-57-4

:

4-Chloro-2-[3-nitro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]phenol

Description:
4-Chloro-2-[3-nitro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]phenol is a complex organic compound characterized by its multi-functional groups, including a chloro substituent, a nitro group, and a phenolic hydroxyl group. The presence of the tetrahydro-2H-pyran moiety contributes to its cyclic structure, enhancing its potential for various chemical interactions. This compound is likely to exhibit moderate to high polarity due to the hydroxyl and nitro groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of bioactive molecules. The chloro and nitro groups may influence its reactivity and solubility in different solvents. Additionally, the presence of the pyrazole ring indicates potential for biological activity, as pyrazoles are known for their diverse pharmacological properties. Overall, this compound's unique structure and functional groups make it a subject of interest in synthetic chemistry and medicinal research.
Formula:C14H14ClN3O4
InChI:InChI=1S/C14H14ClN3O4/c15-9-4-5-12(19)10(7-9)11-8-17(16-14(11)18(20)21)13-3-1-2-6-22-13/h4-5,7-8,13,19H,1-3,6H2
InChI key:InChIKey=QLFJEGZCUOMBAR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(=CN(N1)C2CCCCO2)C3=C(O)C=CC(Cl)=C3
Synonyms:
  • Phenol, 4-chloro-2-[3-nitro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]-
  • 4-Chloro-2-[3-nitro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.