CAS 1235438-82-0

5-Amino-4-phenyl-1H-imidazole-1-acetamide

Description:

5-Amino-4-phenyl-1H-imidazole-1-acetamide is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features an amino group and an acetamide functional group, contributing to its potential biological activity. The presence of the phenyl group enhances its lipophilicity, which may influence its interaction with biological targets. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino and acetamide groups. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as imidazole derivatives are often associated with various pharmacological activities. Additionally, its molecular structure suggests that it could participate in hydrogen bonding, which is crucial for its reactivity and interaction with other molecules. As with any chemical substance, safety data and handling precautions should be observed, especially in laboratory settings.

Formula: C₁₁H₁₂N₄O

InChI: InChI=1S/C11H12N4O/c12-9(16)6-15-7-14-10(11(15)13)8-4-2-1-3-5-8/h1-5,7H,6,13H2,(H2,12,16)

InChI key: InChIKey=UFCPYIQGNWLIOF-UHFFFAOYSA-N

SMILES: NC1=C(N=CN1CC(N)=O)C2=CC=CC=C2

Synonyms:

• 5-Amino-4-phenyl-1H-imidazole-1-acetamide
• 1H-Imidazole-1-acetamide, 5-amino-4-phenyl-

2-(5-Amino-4-phenyl-1H-imidazol-1-yl)acetamide

CAS: 1235438-82-0

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₄O

Purity: Min. 95%

Molecular weight: 216.24 g/mol

Ref: 3D-KZB43882