CAS 1235438-92-2

2-[(4-Bromophenyl)sulfonyl]-2-methyl-1-propanamine

Description:

2-[(4-Bromophenyl)sulfonyl]-2-methyl-1-propanamine, identified by its CAS number 1235438-92-2, is an organic compound characterized by the presence of a sulfonyl group attached to a branched amine structure. This compound features a 4-bromophenyl group, which contributes to its aromatic character and potential reactivity. The sulfonyl moiety enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. The branched amine structure suggests potential for hydrogen bonding and interaction with biological targets. Its molecular structure indicates that it may exhibit properties such as moderate to high lipophilicity, depending on the balance between the hydrophobic aromatic ring and the polar sulfonyl and amine groups. This compound may be utilized in various applications, including pharmaceuticals, where it could serve as a building block or active ingredient. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₄BrNO₂S

InChI: InChI=1S/C10H14BrNO2S/c1-10(2,7-12)15(13,14)9-5-3-8(11)4-6-9/h3-6H,7,12H2,1-2H3

InChI key: InChIKey=UXUZHVXQPDLFOQ-UHFFFAOYSA-N

SMILES: S(C(CN)(C)C)(=O)(=O)C1=CC=C(Br)C=C1

Synonyms:

• 2-[(4-Bromophenyl)sulfonyl]-2-methyl-1-propanamine
• 1-Propanamine, 2-[(4-bromophenyl)sulfonyl]-2-methyl-

2-(4-Bromobenzenesulfonyl)-2-methylpropan-1-amine

CAS: 1235438-92-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄BrNO₂S

Purity: Min. 95%

Molecular weight: 292.19 g/mol

Ref: 3D-KZB43892