
CAS 1235438-95-5
:6-Fluoro-2H-1-benzopyran-3-sulfonyl chloride
Description:
6-Fluoro-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzopyran moiety substituted with a fluorine atom and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. The fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its solubility. As with many sulfonyl chlorides, it is important to handle this compound with care, as it can be corrosive and may release toxic gases upon reaction with water or moisture. Its applications may extend to the development of pharmaceuticals, agrochemicals, or as an intermediate in various chemical syntheses. Proper safety protocols should be followed when working with this substance.
Formula:C9H6ClFO3S
InChI:InChI=1S/C9H6ClFO3S/c10-15(12,13)8-4-6-3-7(11)1-2-9(6)14-5-8/h1-4H,5H2
InChI key:InChIKey=JCLOOGHACKCHEG-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC=2C(OC1)=CC=C(F)C2
Synonyms:- 6-Fluoro-2H-1-benzopyran-3-sulfonyl chloride
- 2H-1-Benzopyran-3-sulfonyl chloride, 6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.