CAS 1235439-18-5

3-Amino-N-methyl-4-(4-thiomorpholinyl)benzamide

Description:

3-Amino-N-methyl-4-(4-thiomorpholinyl)benzamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amino group (-NH2), a methyl group (-CH3), and a thiomorpholine ring, which is a six-membered heterocyclic compound containing sulfur and nitrogen. The presence of the benzamide moiety indicates that it has an amide functional group attached to a benzene ring, contributing to its potential as a pharmacological agent. This compound may exhibit various biological activities due to its structural components, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity would depend on its specific environment and conditions, influencing its practical uses in research and industry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of nitrogen and sulfur in its structure.

Formula: C₁₂H₁₇N₃OS

InChI: InChI=1S/C12H17N3OS/c1-14-12(16)9-2-3-11(10(13)8-9)15-4-6-17-7-5-15/h2-3,8H,4-7,13H2,1H3,(H,14,16)

InChI key: InChIKey=LTLACCZKCRFZKD-UHFFFAOYSA-N

SMILES: NC1=C(C=CC(C(NC)=O)=C1)N2CCSCC2

Synonyms:

• 3-Amino-N-methyl-4-(4-thiomorpholinyl)benzamide
• Benzamide, 3-amino-N-methyl-4-(4-thiomorpholinyl)-