
CAS 1235439-24-3
:6,8-Dimethyl-2H-1-benzopyran-3-sulfonyl chloride
Description:
6,8-Dimethyl-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzopyran core with two methyl groups at the 6 and 8 positions and a sulfonyl chloride functional group at the 3 position. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to react with nucleophiles to form sulfonamides or other derivatives. Additionally, the benzopyran moiety contributes to its potential biological activity, as many compounds in this class exhibit interesting pharmacological properties. As with many sulfonyl chlorides, it is important to handle this compound with care due to its reactivity and potential hazards, including irritation to skin and respiratory pathways. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C11H11ClO3S
InChI:InChI=1S/C11H11ClO3S/c1-7-3-8(2)11-9(4-7)5-10(6-15-11)16(12,13)14/h3-5H,6H2,1-2H3
InChI key:InChIKey=GDDJFWHLMKNCTJ-UHFFFAOYSA-N
SMILES:CC1=C2C(C=C(S(Cl)(=O)=O)CO2)=CC(C)=C1
Synonyms:- 6,8-Dimethyl-2H-1-benzopyran-3-sulfonyl chloride
- 2H-1-Benzopyran-3-sulfonyl chloride, 6,8-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.