CAS 1235439-29-8

Glycine, N-(diphenylmethyl)-, hydrochloride (1:1)

Description:

Glycine, N-(diphenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a glycine moiety and a diphenylmethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. Glycine itself is the simplest amino acid, known for its role as a building block of proteins and its involvement in various metabolic processes. The diphenylmethyl group contributes to the compound's unique properties, potentially influencing its biological activity and interaction with other molecules. As a hydrochloride, it exhibits characteristics such as increased ionic strength and altered pH stability compared to its free base form. This compound may be of interest in pharmaceutical research and development due to its potential applications in drug formulation and synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₅NO₂·ClH

InChI: InChI=1S/C15H15NO2.ClH/c17-14(18)11-16-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,15-16H,11H2,(H,17,18);1H

InChI key: InChIKey=FHWSJVWIVPKMIC-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)(C1=CC=CC=C1)C2=CC=CC=C2.Cl

Synonyms:

• Glycine, N-(diphenylmethyl)-, hydrochloride (1:1)

2-[(Diphenylmethyl)amino]acetic acid hydrochloride

CAS: 1235439-29-8

Versatile small molecule scaffold

Formula: C₁₅H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 277.74 g/mol

Ref: 3D-KZB43929