CAS 1235439-30-1

Methyl 1,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate

Description:

Methyl 1,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both triazole and pyrimidine moieties. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential bioactivity, which may include antimicrobial or antifungal effects, although specific biological activities can vary. The presence of the methyl ester functional group contributes to its reactivity and potential for further chemical modifications. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound's CAS number, 1235439-30-1, allows for precise identification in chemical databases, facilitating research and application in medicinal chemistry and drug development. Overall, this compound represents a class of triazolopyrimidine derivatives that are of interest for their synthetic versatility and potential pharmacological properties.

Formula: C₇H₁₀N₄O₂

InChI: InChI=1S/C7H10N4O2/c1-13-6(12)5-9-7-8-3-2-4-11(7)10-5/h2-4H2,1H3,(H,8,9,10)

InChI key: InChIKey=PMZDTUQFJNEQNX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2N(N1)CCCN2

Synonyms:

• Methyl 1,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate
• [1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid, 1,5,6,7-tetrahydro-, methyl ester

Methyl 4H,5H,6H,7H-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate

CAS: 1235439-30-1

Versatile small molecule scaffold

Formula: C₇H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 182.18 g/mol

Ref: 3D-KZB43930