CymitQuimica logo

CAS 1235439-63-0

:

S-(1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl) N,N-dimethylcarbamothioate

Description:
S-(1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl) N,N-dimethylcarbamothioate is a chemical compound characterized by its unique structure, which includes a pyrazolo-pyridine moiety and a carbamothioate functional group. This compound typically exhibits properties associated with both heterocyclic compounds and thioesters, which may influence its reactivity and biological activity. It is likely to be a solid at room temperature, with potential solubility in organic solvents due to the presence of the pyrazolo-pyridine ring. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. As with many chemical substances, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound represents a class of chemicals that could have significant implications in research and pharmaceutical applications.
Formula:C11H14N4OS
InChI:InChI=1S/C11H14N4OS/c1-7-9-5-8(17-11(16)14(2)3)6-12-10(9)15(4)13-7/h5-6H,1-4H3
InChI key:InChIKey=FUABDTDDLQNZNM-UHFFFAOYSA-N
SMILES:CC=1C=2C(N(C)N1)=NC=C(SC(N(C)C)=O)C2
Synonyms:
  • Carbamothioic acid, N,N-dimethyl-, S-(1,3-dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl) ester
  • S-(1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl) N,N-dimethylcarbamothioate
Found 1 products.