CAS 1235439-65-2

1,1-Dimethylethyl 2-[[(4-aminobenzoyl)oxy]methyl]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 2-[[(4-aminobenzoyl)oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1235439-65-2, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group, which contributes to its steric bulk, and an aminobenzoyl moiety that suggests potential biological activity, possibly as a pharmaceutical agent. The ester functional group indicates that it can undergo hydrolysis, making it reactive in various chemical environments. Its structure suggests it may interact with biological systems, potentially serving as a prodrug or a targeted delivery mechanism due to the presence of the amino group. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other reactants. Overall, this compound's unique structural features may lend it interesting properties for applications in medicinal chemistry or materials science.

Formula: C₁₇H₂₄N₂O₄

InChI: InChI=1S/C17H24N2O4/c1-17(2,3)23-16(21)19-10-4-5-14(19)11-22-15(20)12-6-8-13(18)9-7-12/h6-9,14H,4-5,10-11,18H2,1-3H3

InChI key: InChIKey=QLRFXKYTGSVXQJ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(COC(=O)C2=CC=C(N)C=C2)CCC1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 2-[[(4-aminobenzoyl)oxy]methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[[(4-aminobenzoyl)oxy]methyl]-1-pyrrolidinecarboxylate

tert-Butyl 2-[(4-aminobenzoyloxy)methyl]pyrrolidine-1-carboxylate

CAS: 1235439-65-2

Versatile small molecule scaffold

Formula: C₁₇H₂₄N₂O₄

Purity: Min. 95%

Molecular weight: 320.4 g/mol

Ref: 3D-KZB43965