CAS 1235439-66-3

Benzenemethanamine, 5-bromo-N-ethyl-2-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, 5-bromo-N-ethyl-2-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and halogen substituents. It features a benzene ring substituted with a bromo group at the 5-position and an ethyl group attached to the nitrogen atom of the amine. The presence of a fluorine atom at the 2-position of the benzene ring contributes to its unique reactivity and potential applications in pharmaceuticals or agrochemicals. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various chemical processes. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. Its CAS number, 1235439-66-3, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with functionalized aromatic systems.

Formula: C₉H₁₁BrFN·ClH

InChI: InChI=1S/C9H11BrFN.ClH/c1-2-12-6-7-5-8(10)3-4-9(7)11;/h3-5,12H,2,6H2,1H3;1H

InChI key: InChIKey=CRLDTPMKPCESLD-UHFFFAOYSA-N

SMILES: C(NCC)C1=C(F)C=CC(Br)=C1.Cl

Synonyms:

• Benzenemethanamine, 5-bromo-N-ethyl-2-fluoro-, hydrochloride (1:1)

N-(5-Bromo-2-fluorobenzyl)ethanamine hydrochloride

CAS: 1235439-66-3

N-(5-Bromo-2-fluorobenzyl)ethanamine hydrochloride

Purity: 95%

Molecular weight: 268.56g/mol

Ref: 54-PC1002655

[(5-Bromo-2-fluorophenyl)methyl](ethyl)amine hydrochloride

CAS: 1235439-66-3

Versatile small molecule scaffold

Formula: C₉H₁₂BrClFN

Purity: Min. 95%

Molecular weight: 268.55 g/mol

Ref: 3D-KZB43966