CAS 1235439-73-2

4-Piperidinamine, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:3)

Description:

4-Piperidinamine, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:3) is a chemical compound characterized by its piperidine and morpholine functional groups, which contribute to its potential biological activity. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is advantageous for pharmaceutical applications. The presence of the piperidine ring provides basic properties, while the morpholine moiety may impart additional steric and electronic characteristics that influence its interaction with biological targets. The compound's structure suggests potential use in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, pharmacokinetics, and toxicity profiles would require further investigation through experimental studies. As with many amines, it may exhibit basicity and can form salts with acids, which is relevant for formulation in drug development. Overall, the compound's unique structural features position it as a candidate for further research in various chemical and biological contexts.

Formula: C₁₁H₂₃N₃O·3ClH

InChI: InChI=1S/C11H23N3O.3ClH/c12-11-1-3-13(4-2-11)5-6-14-7-9-15-10-8-14;;;/h11H,1-10,12H2;3*1H

InChI key: InChIKey=YENHEZHJLRKQKA-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[2-(4-morpholinyl)ethyl]-, hydrochloride (1:3)

1-[2-(Morpholin-4-yl)ethyl]piperidin-4-amine trihydrochloride

CAS: 1235439-73-2

Versatile small molecule scaffold

Formula: C₁₁H₂₆Cl₃N₃O

Purity: Min. 95%

Molecular weight: 322.7 g/mol

Ref: 3D-KZB43973