CAS 1235439-76-5

1,2,4-Oxadiazole-5-propanamine, 3-(1-methylethyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-propanamine, 3-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which contributes to its potential biological activity. The presence of the propanamine group suggests it may exhibit amine-related properties, such as basicity and the ability to form hydrogen bonds. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacokinetic properties. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various biological activities, including antimicrobial or anti-inflammatory effects. Its molecular structure includes a branched alkyl group (isopropyl), which can affect its lipophilicity and interaction with biological membranes. As with many compounds in this class, further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications in pharmaceuticals or other fields.

Formula: C₈H₁₅N₃O·ClH

InChI: InChI=1S/C8H15N3O.ClH/c1-6(2)8-10-7(12-11-8)4-3-5-9;/h6H,3-5,9H2,1-2H3;1H

InChI key: InChIKey=AURHWNKGACLLQF-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N=C(CCCN)ON1.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-propanamine, 3-(1-methylethyl)-, hydrochloride (1:1)

3-[3-(Propan-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-amine hydrochloride

CAS: 1235439-76-5

Versatile small molecule scaffold

Formula: C₈H₁₆ClN₃O

Purity: Min. 95%

Molecular weight: 205.68 g/mol

Ref: 3D-KZB43976