CAS 1235439-87-8

Quinoline, 6-bromo-8-fluoro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

Quinoline, 6-bromo-8-fluoro-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a quinoline backbone modified with bromine and fluorine substituents. The presence of the bromine atom at the 6-position and the fluorine atom at the 8-position contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals and research. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure that may influence its pharmacological properties. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1235439-87-8, allows for precise identification and retrieval of information related to its properties, synthesis, and applications in scientific literature.

Formula: C₉H₉BrFN.ClH

InChI: InChI=1S/C9H9BrFN.ClH/c10-7-4-6-2-1-3-12-9(6)8(11)5-7;/h4-5,12H,1-3H2;1H

InChI key: InChIKey=SAYHINNJNGVRQX-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC(Br)=C1)CCCN2.Cl

6-Bromo-8-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride

CAS: 1235439-87-8

Versatile small molecule scaffold

Formula: C₉H₁₀BrClFN

Purity: Min. 95%

Molecular weight: 266.54 g/mol

Ref: 3D-KZB43987