CAS 1235439-94-7

6-Ethoxy-2H-1-benzopyran-3-sulfonyl chloride

Description:

6-Ethoxy-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzopyran core, an ethoxy group, and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its specific form and purity. The presence of the sulfonyl chloride group indicates that it is a reactive species, often used in organic synthesis as a sulfonylating agent. The ethoxy group contributes to its solubility properties, making it more amenable to reactions in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its reactivity allows it to participate in nucleophilic substitution reactions, which can be utilized to introduce other functional groups into a molecule. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 6-Ethoxy-2H-1-benzopyran-3-sulfonyl chloride is a versatile compound with applications in synthetic organic chemistry.

Formula: C₁₁H₁₁ClO₄S

InChI: InChI=1S/C11H11ClO4S/c1-2-15-9-3-4-11-8(5-9)6-10(7-16-11)17(12,13)14/h3-6H,2,7H2,1H3

InChI key: InChIKey=GEHQROQWZYGKJT-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC=2C(OC1)=CC=C(OCC)C2

Synonyms:

• 6-Ethoxy-2H-1-benzopyran-3-sulfonyl chloride
• 2H-1-Benzopyran-3-sulfonyl chloride, 6-ethoxy-