CAS 1235440-16-0

Benzenemethanol, α-(aminomethyl)-α,3-bis(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(aminomethyl)-α,3-bis(trifluoromethyl)-, hydrochloride (1:1), with CAS number 1235440-16-0, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a hydroxymethyl group and two trifluoromethyl groups at the 3-position. The presence of an amino group contributes to its basicity and potential reactivity in various chemical reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical applications. The trifluoromethyl groups impart unique electronic properties, making this compound of interest in medicinal chemistry and materials science. Its specific interactions and stability can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique functional groups and structural features suggest potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis.

Formula: C₁₀H₉F₆NO·ClH

InChI: InChI=1S/C10H9F6NO.ClH/c11-9(12,13)7-3-1-2-6(4-7)8(18,5-17)10(14,15)16;/h1-4,18H,5,17H2;1H

InChI key: InChIKey=DCGWDCXUUQMAJK-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(CN)(O)C1=CC(C(F)(F)F)=CC=C1.Cl

Synonyms:

• Benzenemethanol, α-(aminomethyl)-α,3-bis(trifluoromethyl)-, hydrochloride (1:1)

3-Amino-1,1,1-trifluoro-2-[3-(trifluoromethyl)phenyl]propan-2-ol hydrochloride

CAS: 1235440-16-0

Versatile small molecule scaffold

Formula: C₁₀H₁₀ClF₆NO

Purity: Min. 95%

Molecular weight: 309.63 g/mol

Ref: 3D-KZB44016