CAS 1235440-18-2

2-Piperidinone, 5-amino-, hydrochloride (1:1)

Description:

2-Piperidinone, 5-amino-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing nitrogen and a carbonyl group. The presence of an amino group at the 5-position contributes to its basicity and potential reactivity, making it a valuable intermediate in organic synthesis and pharmaceutical applications. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in biological systems. This compound may exhibit properties such as being hygroscopic and having a specific melting point, which can vary based on purity and environmental conditions. Its applications may include roles in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₅H₁₀N₂O·ClH

InChI: InChI=1S/C5H10N2O.ClH/c6-4-1-2-5(8)7-3-4;/h4H,1-3,6H2,(H,7,8);1H

InChI key: InChIKey=KFJLLOJCPFYWRV-UHFFFAOYSA-N

SMILES: NC1CCC(=O)NC1.Cl

Synonyms:

• 2-Piperidinone, 5-amino-, hydrochloride (1:1)
• 5-Aminopiperidin-2-one hydrochloride

2-Piperidinone, 5-amino-, hydrochloride (1:1)

CAS: 1235440-18-2

Formula: C₅H₁₁ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 150.6066

Ref: IN-DA000KS7

5-Aminopiperidin-2-one hydrochloride

CAS: 1235440-18-2

5-Aminopiperidin-2-one hydrochloride

Purity: 97%

Ref: 54-OR1041830

5-Aminopiperidin-2-one hydrochloride

CAS: 1235440-18-2

Formula: C₅H₁₁ClN₂O

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 150.61

Ref: 10-F412235

5-aminopiperidin-2-one hydrochloride

CAS: 1235440-18-2

5-aminopiperidin-2-one hydrochloride is a lactam with an intramolecular ring. It is an alkaline compound that has the properties of aminolysis and assessing. 5-aminopiperidin-2-one hydrochloride is used to produce other compounds, such as 6-membered lactams, by reacting with various amines. This reaction can be conducted in the presence of a base or at high temperatures, depending on the desired product.

Formula: C₅H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 150.61 g/mol

Ref: 3D-KZB44018