CAS 1235440-20-6

1-(3-Nitro-2-pyridinyl)-4-piperidinemethanol

Description:

1-(3-Nitro-2-pyridinyl)-4-piperidinemethanol is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety with a nitro substituent. The presence of the nitro group indicates potential reactivity and polar characteristics, while the piperidine ring contributes to its basicity and potential for forming hydrogen bonds due to the hydroxyl group attached to the piperidine. This compound may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The specific interactions and biological activity would depend on the compound's ability to interact with various biological targets, influenced by its functional groups and overall molecular geometry. As with many nitrogen-containing heterocycles, it may also display interesting pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME) profiles, making it a subject of interest in drug discovery research.

Formula: C₁₁H₁₅N₃O₃

InChI: InChI=1S/C11H15N3O3/c15-8-9-3-6-13(7-4-9)11-10(14(16)17)2-1-5-12-11/h1-2,5,9,15H,3-4,6-8H2

InChI key: InChIKey=DATSLEILKRNRMZ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(N=CC=C1)N2CCC(CO)CC2

Synonyms:

• 1-(3-Nitro-2-pyridinyl)-4-piperidinemethanol
• 4-Piperidinemethanol, 1-(3-nitro-2-pyridinyl)-

[1-(3-Nitropyridin-2-yl)piperidin-4-yl]methanol

CAS: 1235440-20-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅N₃O₃

Purity: Min. 95%

Molecular weight: 237.25 g/mol

Ref: 3D-KZB44020