CAS 1235440-21-7

3-Piperidinecarboxamide, N-(1-methylbutyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-(1-methylbutyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) attached to a nitrogen atom (N), which contributes to its solubility and reactivity. The N-(1-methylbutyl) substituent suggests that the piperidine nitrogen is bonded to a branched alkyl chain, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as moderate to high polarity, and its interactions can be influenced by the presence of the hydrochloride moiety. Overall, this substance is of interest in medicinal chemistry and pharmacology, where its structural features may correlate with specific biological activities or therapeutic effects.

Formula: C₁₁H₂₂N₂O·ClH

InChI: InChI=1S/C11H22N2O.ClH/c1-3-5-9(2)13-11(14)10-6-4-7-12-8-10;/h9-10,12H,3-8H2,1-2H3,(H,13,14);1H

InChI key: InChIKey=RSZBGPFFVMENPL-UHFFFAOYSA-N

SMILES: C(NC(CCC)C)(=O)C1CCCNC1.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-(1-methylbutyl)-, hydrochloride (1:1)

N-(Pentan-2-yl)piperidine-3-carboxamide hydrochloride

CAS: 1235440-21-7

Versatile small molecule scaffold

Formula: C₁₁H₂₃ClN₂O

Purity: Min. 95%

Molecular weight: 234.76 g/mol

Ref: 3D-KZB44021