
CAS 1235440-32-0
:8-Chloro-2H-1-benzopyran-3-sulfonyl chloride
Description:
8-Chloro-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzopyran moiety and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions, making it useful in various synthetic applications. The chlorine atom at the 8-position of the benzopyran ring contributes to its electrophilic nature, enhancing its potential as an intermediate in organic synthesis. Additionally, this compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its solubility characteristics can vary, often being soluble in polar organic solvents. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines. Overall, 8-Chloro-2H-1-benzopyran-3-sulfonyl chloride is a versatile compound with significant implications in chemical research and development.
Formula:C9H6Cl2O3S
InChI:InChI=1S/C9H6Cl2O3S/c10-8-3-1-2-6-4-7(15(11,12)13)5-14-9(6)8/h1-4H,5H2
InChI key:InChIKey=DVDOSNOHDJRZNC-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(S(Cl)(=O)=O)CO2)=CC=C1
Synonyms:- 2H-1-Benzopyran-3-sulfonyl chloride, 8-chloro-
- 8-Chloro-2H-1-benzopyran-3-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.