CAS 1235440-38-6

Benzeneethanamine, 4-(cyclopentyloxy)-, hydrochloride (1:1)

Description:

Benzeneethanamine, 4-(cyclopentyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclopentyloxy substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the cyclopentyloxy group contributes to its unique properties, potentially influencing its biological activity and interaction with various receptors. As a hydrochloride salt, it is often more stable and easier to handle in laboratory settings. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its pharmacological effects, toxicity, and environmental impact would be necessary to fully understand its applications and safety profile. As with all chemical substances, proper safety protocols should be followed when handling this compound.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c14-10-9-11-5-7-13(8-6-11)15-12-3-1-2-4-12;/h5-8,12H,1-4,9-10,14H2;1H

InChI key: InChIKey=JOGDKPSQYLPTEX-UHFFFAOYSA-N

SMILES: O(C1=CC=C(CCN)C=C1)C2CCCC2.Cl

Synonyms:

• Benzeneethanamine, 4-(cyclopentyloxy)-, hydrochloride (1:1)

2-[4-(Cyclopentyloxy)phenyl]ethan-1-amine hydrochloride

Controlled Product

CAS: 1235440-38-6

Versatile small molecule scaffold

Formula: C₁₃H₂₀ClNO

Purity: Min. 95%

Molecular weight: 241.76 g/mol

Ref: 3D-KZB44038