CymitQuimica logo

CAS 1235440-43-3

:

4-Phenyl-1-(2-propen-1-yl)-1H-imidazol-5-amine

Description:
4-Phenyl-1-(2-propen-1-yl)-1H-imidazol-5-amine is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a phenyl group and a propenyl substituent, contributing to its unique structural and chemical properties. The presence of the amine functional group indicates potential basicity and reactivity, particularly in forming hydrogen bonds or participating in nucleophilic reactions. Its molecular structure suggests potential applications in medicinal chemistry, possibly as a scaffold for drug development or as a ligand in coordination chemistry. The compound's specific interactions, solubility, and stability would depend on its environment, including pH and solvent conditions. Additionally, the presence of multiple functional groups may allow for diverse reactivity, making it a candidate for further chemical modifications. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C12H13N3
InChI:InChI=1S/C12H13N3/c1-2-8-15-9-14-11(12(15)13)10-6-4-3-5-7-10/h2-7,9H,1,8,13H2
InChI key:InChIKey=SQQMAZMNVKXFHI-UHFFFAOYSA-N
SMILES:NC1=C(N=CN1CC=C)C2=CC=CC=C2
Synonyms:
  • 3-Allyl-5-phenyl-3H-imidazol-4-ylamine
  • 4-Phenyl-1-(2-propen-1-yl)-1H-imidazol-5-amine
  • 1H-Imidazol-5-amine, 4-phenyl-1-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.