CAS 1235440-53-5

Acetamide, 2-amino-N-(3-ethylphenyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(3-ethylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features an amino group and a phenyl ring substituted with an ethyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential basicity, while the acetamide structure indicates it may exhibit both polar and non-polar characteristics, influencing its interactions in biological systems. The compound may be used in research settings, particularly in studies related to medicinal chemistry or drug development, due to its structural features that could interact with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₄N₂O·ClH

InChI: InChI=1S/C10H14N2O.ClH/c1-2-8-4-3-5-9(6-8)12-10(13)7-11;/h3-6H,2,7,11H2,1H3,(H,12,13);1H

InChI key: InChIKey=OQRNMZSXDVGVGW-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C1=CC(CC)=CC=C1.Cl

Synonyms:

• Acetamide, 2-amino-N-(3-ethylphenyl)-, hydrochloride (1:1)

2-Amino-N-(3-ethylphenyl)acetamide hydrochloride

CAS: 1235440-53-5

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 214.69 g/mol

Ref: 3D-KZB44053