CymitQuimica logo

CAS 1235440-58-0

:

Piperidine, 4-(5-phenyl-1H-1,2,4-triazol-3-yl)-, hydrochloride (1:1)

Description:
Piperidine, 4-(5-phenyl-1H-1,2,4-triazol-3-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a phenyl group and a 1H-1,2,4-triazole moiety, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the triazole ring suggests potential antifungal or antimicrobial properties, as triazoles are known for their role in various therapeutic agents. The compound's structure indicates it may interact with biological targets, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can be influenced by the pH of the environment, and it may exhibit specific pharmacokinetic properties relevant to drug development. Overall, this compound represents a class of substances that may have significant implications in drug discovery and development.
Formula:C13H16N4·ClH
InChI:InChI=1S/C13H16N4.ClH/c1-2-4-10(5-3-1)12-15-13(17-16-12)11-6-8-14-9-7-11;/h1-5,11,14H,6-9H2,(H,15,16,17);1H
InChI key:InChIKey=XEWVGXTWOSQZES-UHFFFAOYSA-N
SMILES:C=1(NC(=NN1)C2CCNCC2)C3=CC=CC=C3.Cl
Synonyms:
  • Piperidine, 4-(5-phenyl-1H-1,2,4-triazol-3-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.