CymitQuimica logo

CAS 1235440-59-1

:

N-Methyl-3-methylenecyclobutanamine

Description:
N-Methyl-3-methylenecyclobutanamine is a chemical compound characterized by its unique cyclic structure and the presence of a methylene group. As a derivative of cyclobutane, it features a four-membered ring with a nitrogen atom substituted with a methyl group, which influences its reactivity and potential applications. The presence of the methylene group contributes to its overall stability and may affect its interaction with other chemical species. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and structural properties. Its specific characteristics, such as solubility, boiling point, and reactivity, can vary based on environmental conditions and the presence of functional groups. As with many nitrogen-containing compounds, it may exhibit basic properties and participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. However, detailed studies and analyses are necessary to fully understand its behavior and potential applications in different chemical contexts.
Formula:C6H11N
InChI:InChI=1S/C6H11N/c1-5-3-6(4-5)7-2/h6-7H,1,3-4H2,2H3
InChI key:InChIKey=IAVNOPUJGMLCDB-UHFFFAOYSA-N
SMILES:N(C)C1CC(=C)C1
Synonyms:
  • Cyclobutanamine, N-methyl-3-methylene-
  • N-Methyl-3-methylenecyclobutanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.