CAS 1235440-78-4

Cyclobutanemethanamine, 1-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

Description:

Cyclobutanemethanamine, 1-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an amine functional group. The presence of a tert-butyl group on the phenyl ring contributes to its hydrophobic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound may exhibit biological activity due to the amine functionality, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form is often preferred for stability and ease of handling. As with many amines, it may exhibit basicity, allowing it to form complexes with acids. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₅H₂₃N·ClH

InChI: InChI=1S/C15H23N.ClH/c1-14(2,3)12-5-7-13(8-6-12)15(11-16)9-4-10-15;/h5-8H,4,9-11,16H2,1-3H3;1H

InChI key: InChIKey=MLMMGFSNSZJJMS-UHFFFAOYSA-N

SMILES: C(N)C1(CCC1)C2=CC=C(C(C)(C)C)C=C2.Cl

Synonyms:

• Cyclobutanemethanamine, 1-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

[1-(4-tert-Butylphenyl)cyclobutyl]methanamine hydrochloride

CAS: 1235440-78-4

Formula: C₁₅H₂₄ClN

Purity: 90%

Molecular weight: 253.8108

Ref: IN-DA01A8ET

[1-(4-tert-Butylphenyl)cyclobutyl]methanamine hydrochloride

CAS: 1235440-78-4

Versatile small molecule scaffold

Formula: C₁₅H₂₄ClN

Purity: Min. 95%

Molecular weight: 253.81 g/mol

Ref: 3D-KZB44078