CAS 1235440-79-5

Acetamide, 2-[(2-methoxyethyl)amino]-, hydrochloride (1:1)

Description:

Acetamide, 2-[(2-methoxyethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a methoxyethyl substituent. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The compound features a two-carbon chain linked to an amine group, contributing to its potential biological activity. It may exhibit properties such as moderate polarity and the ability to participate in hydrogen bonding due to the presence of both amide and amine functionalities. The hydrochloride form often stabilizes the compound and can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. As with many amides, it may also display low volatility and moderate thermal stability. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₅H₁₂N₂O₂·ClH

InChI: InChI=1S/C5H12N2O2.ClH/c1-9-3-2-7-4-5(6)8;/h7H,2-4H2,1H3,(H2,6,8);1H

InChI key: InChIKey=LYZGRXRVXHMQHW-UHFFFAOYSA-N

SMILES: N(CC(N)=O)CCOC.Cl

Synonyms:

• Acetamide, 2-[(2-methoxyethyl)amino]-, hydrochloride (1:1)

2-[(2-Methoxyethyl)amino]acetamide hydrochloride

CAS: 1235440-79-5

Versatile small molecule scaffold

Formula: C₅H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 168.62 g/mol

Ref: 3D-KZB44079