CAS 1235440-94-4

2-Chloro-N-[phenyl[2-(trifluoromethyl)-1H-benzimidazol-6-yl]methyl]acetamide

Description:

2-Chloro-N-[phenyl[2-(trifluoromethyl)-1H-benzimidazol-6-yl]methyl]acetamide is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a phenyl moiety, and a benzimidazole derivative with a trifluoromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's pharmacokinetic properties. The chloro substituent may also impart unique reactivity, making it a candidate for various chemical transformations. In terms of solubility, compounds of this nature may be soluble in organic solvents but less so in water, reflecting the influence of their functional groups. Additionally, the compound may exhibit specific interactions with biological targets, which could be of interest in medicinal chemistry. Overall, 2-Chloro-N-[phenyl[2-(trifluoromethyl)-1H-benzimidazol-6-yl]methyl]acetamide represents a class of compounds that could have applications in pharmaceuticals or agrochemicals.

Formula: C₁₇H₁₃ClF₃N₃O

InChI: InChI=1S/C17H13ClF3N3O/c18-9-14(25)24-15(10-4-2-1-3-5-10)11-6-7-12-13(8-11)23-16(22-12)17(19,20)21/h1-8,15H,9H2,(H,22,23)(H,24,25)

InChI key: InChIKey=XOPMOURJFBEDNH-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(C=1C=C2C(=CC1)N=C(C(F)(F)F)N2)C3=CC=CC=C3

Synonyms:

• 2-Chloro-N-[phenyl[2-(trifluoromethyl)-1H-benzimidazol-6-yl]methyl]acetamide
• Acetamide, 2-chloro-N-[phenyl[2-(trifluoromethyl)-1H-benzimidazol-6-yl]methyl]-

2-Chloro-N-{phenyl[2-(trifluoromethyl)-1H-1,3-benzodiazol-5-yl]methyl}acetamide

CAS: 1235440-94-4

Versatile small molecule scaffold

Formula: C₁₇H₁₃ClF₃N₃O

Purity: Min. 95%

Molecular weight: 367.8 g/mol

Ref: 3D-KZB44094