CymitQuimica logo

CAS 1235441-13-0

:

1H-Imidazo[4,5-c]pyridine, 1-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:2)

Description:
1H-Imidazo[4,5-c]pyridine, 1-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a cyclopropyl group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the tetrahydro moiety indicates that the compound has undergone hydrogenation, which can influence its reactivity and interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would be essential for further applications and research. As with many heterocyclic compounds, it may also participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the functional groups present.
Formula:C9H13N3·2ClH
InChI:InChI=1S/C9H13N3.2ClH/c1-2-7(1)12-6-11-8-5-10-4-3-9(8)12;;/h6-7,10H,1-5H2;2*1H
InChI key:InChIKey=YBJQJGRCNUUMEM-UHFFFAOYSA-N
SMILES:N1(C2=C(N=C1)CNCC2)C3CC3.Cl
Synonyms:
  • 1H-Imidazo[4,5-c]pyridine, 1-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.