CAS 1235441-19-6

4-Piperidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the N-(4-bromophenyl) group indicates that a bromophenyl moiety is attached to the nitrogen atom of the piperidine, contributing to its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for potential therapeutic applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for applications in treating various conditions. Safety and handling precautions are essential, as with any chemical substance, particularly those with halogenated aromatic groups, due to potential toxicity and environmental impact.

Formula: C₁₂H₁₅BrN₂O·ClH

InChI: InChI=1S/C12H15BrN2O.ClH/c13-10-1-3-11(4-2-10)15-12(16)9-5-7-14-8-6-9;/h1-4,9,14H,5-8H2,(H,15,16);1H

InChI key: InChIKey=RIPWOIVCXTXUFO-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Br)C=C1)(=O)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1)

N-(4-Bromophenyl)piperidine-4-carboxamide hydrochloride

CAS: 1235441-19-6

Versatile small molecule scaffold

Formula: C₁₂H₁₆BrClN₂O

Purity: Min. 95%

Molecular weight: 319.62 g/mol

Ref: 3D-KZB44119