CymitQuimica logo

CAS 1235441-21-0

:

2-(Methylsulfonyl)cyclohexanamine

Description:
2-(Methylsulfonyl)cyclohexanamine is an organic compound characterized by a cyclohexane ring substituted with an amine group and a methylsulfonyl group. The presence of the methylsulfonyl group introduces both polar and nonpolar characteristics, influencing the compound's solubility and reactivity. This compound typically exhibits moderate to high polarity due to the sulfonyl functional group, which can engage in hydrogen bonding and dipole-dipole interactions. The amine group contributes basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the cyclohexane structure provides a stable, saturated framework that can affect the compound's conformational flexibility. 2-(Methylsulfonyl)cyclohexanamine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular environment and the presence of other substituents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H15NO2S
InChI:InChI=1S/C7H15NO2S/c1-11(9,10)7-5-3-2-4-6(7)8/h6-7H,2-5,8H2,1H3
InChI key:InChIKey=MBOUYTIVZNSOKX-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1C(N)CCCC1
Synonyms:
  • Cyclohexanamine, 2-(methylsulfonyl)-
  • 2-(Methylsulfonyl)cyclohexanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.