
CAS 1235441-28-7
:1-(Methylsulfonyl)cyclopentanemethanamine
Description:
1-(Methylsulfonyl)cyclopentanemethanamine, identified by its CAS number 1235441-28-7, is an organic compound characterized by the presence of a cyclopentane ring substituted with a methylsulfonyl group and an amine functional group. This compound typically exhibits properties associated with both amines and sulfonyl compounds, such as potential basicity due to the amine group and polar characteristics from the sulfonyl moiety. The methylsulfonyl group can enhance the solubility of the compound in polar solvents, while the cyclopentane structure contributes to its overall three-dimensional conformation, which may influence its reactivity and interactions with biological systems. The presence of the amine group suggests potential for hydrogen bonding, which can affect its physical properties, such as boiling and melting points. Additionally, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with biological targets. However, specific data regarding its toxicity, stability, and reactivity would require further investigation.
Formula:C7H15NO2S
InChI:InChI=1S/C7H15NO2S/c1-11(9,10)7(6-8)4-2-3-5-7/h2-6,8H2,1H3
InChI key:InChIKey=YIHCDJHLBGVHNU-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1(CN)CCCC1
Synonyms:- (1-(Methylsulfonyl)cyclopentyl)methanamine
- 1-(Methylsulfonyl)cyclopentanemethanamine
- Cyclopentanemethanamine, 1-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.