CAS 1235441-53-8

4-Piperidinecarboxamide, N-(3-fluorophenyl)-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-(3-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a carboxamide functional group contributes to its potential as a pharmacologically active agent. The compound features a 3-fluorophenyl substituent, which may influence its biological activity and interaction with various receptors or enzymes. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure suggests potential uses in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric disorders. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Safety data and handling precautions are essential, as with any chemical substance, to mitigate risks associated with its use in research or industrial applications.

Formula: C₁₂H₁₅FN₂O·ClH

InChI: InChI=1S/C12H15FN2O.ClH/c13-10-2-1-3-11(8-10)15-12(16)9-4-6-14-7-5-9;/h1-3,8-9,14H,4-7H2,(H,15,16);1H

InChI key: InChIKey=POTRFOYLSYTNPI-UHFFFAOYSA-N

SMILES: C(NC1=CC(F)=CC=C1)(=O)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-(3-fluorophenyl)-, hydrochloride (1:1)

N-(3-Fluorophenyl)piperidine-4-carboxamide hydrochloride

CAS: 1235441-53-8

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClFN₂O

Purity: Min. 95%

Molecular weight: 258.72 g/mol

Ref: 3D-KZB44153