CAS 1235441-62-9

1H-Indole-1-acetamide, 5-amino-N,N-diethyl-, hydrochloride (1:1)

Description:

1H-Indole-1-acetamide, 5-amino-N,N-diethyl-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features an acetamide group and two diethyl groups attached to the nitrogen atom at the 5-position of the indole ring, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for various applications. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a precursor in pharmaceutical synthesis. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry. As with many indole derivatives, it may also possess properties such as fluorescence or photostability, which can be advantageous in research and development contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₁₉N₃O·ClH

InChI: InChI=1S/C14H19N3O.ClH/c1-3-16(4-2)14(18)10-17-8-7-11-9-12(15)5-6-13(11)17;/h5-9H,3-4,10,15H2,1-2H3;1H

InChI key: InChIKey=DWPRLODGIIYCEX-UHFFFAOYSA-N

SMILES: C(C(N(CC)CC)=O)N1C=2C(C=C1)=CC(N)=CC2.Cl

Synonyms:

• 1H-Indole-1-acetamide, 5-amino-N,N-diethyl-, hydrochloride (1:1)

2-(5-Amino-1H-indol-1-yl)-N,N-diethylacetamide hydrochloride

CAS: 1235441-62-9

Versatile small molecule scaffold

Formula: C₁₄H₂₀ClN₃O

Purity: Min. 95%

Molecular weight: 281.78 g/mol

Ref: 3D-KZB44162