CymitQuimica logo

CAS 1235441-64-1

:

5,7-Difluoro-2H-1-benzopyran-3-sulfonyl chloride

Description:
5,7-Difluoro-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzopyran core substituted with two fluorine atoms and a sulfonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and sulfonyl chloride functionalities, such as reactivity towards nucleophiles due to the presence of the sulfonyl chloride group, which can participate in various chemical reactions, including acylation and sulfonylation. The fluorine substituents can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. Additionally, the presence of the benzopyran moiety may impart biological activity, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature and may require careful handling due to the reactive nature of the sulfonyl chloride group. As with many synthetic organic compounds, safety precautions should be observed when working with this substance, including the use of appropriate personal protective equipment and working in a well-ventilated area.
Formula:C9H5ClF2O3S
InChI:InChI=1S/C9H5ClF2O3S/c10-16(13,14)6-3-7-8(12)1-5(11)2-9(7)15-4-6/h1-3H,4H2
InChI key:InChIKey=OBKVEIGPOUOMRU-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(F)=C1)OCC(S(Cl)(=O)=O)=C2
Synonyms:
  • 5,7-Difluoro-2H-1-benzopyran-3-sulfonyl chloride
  • 2H-1-Benzopyran-3-sulfonyl chloride, 5,7-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.