CAS 1235441-66-3

6-Chloro-2H-1-benzopyran-3-sulfonyl chloride

Description:

6-Chloro-2H-1-benzopyran-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a benzopyran structure, which is a fused ring system consisting of a benzene ring and a pyran ring, contributing to its aromatic properties. The presence of the chlorine atom at the 6-position of the benzopyran enhances its electrophilic character, making it useful in various synthetic applications, particularly in the formation of more complex molecules. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, facilitating the introduction of sulfonyl groups into other compounds. The compound is likely to be sensitive to moisture and should be handled with care, as sulfonyl chlorides can release hydrochloric acid upon hydrolysis. Overall, 6-Chloro-2H-1-benzopyran-3-sulfonyl chloride is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.

Formula: C₉H₆Cl₂O₃S

InChI: InChI=1S/C9H6Cl2O3S/c10-7-1-2-9-6(3-7)4-8(5-14-9)15(11,12)13/h1-4H,5H2

InChI key: InChIKey=HAOUOEPGUNIORC-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC=2C(OC1)=CC=C(Cl)C2

Synonyms:

• 2H-1-Benzopyran-3-sulfonyl chloride, 6-chloro-
• 6-Chloro-2H-1-benzopyran-3-sulfonyl chloride

6-Chloro-2H-chromene-3-sulfonyl chloride

CAS: 1235441-66-3

Versatile small molecule scaffold

Formula: C₉H₆Cl₂O₃S

Purity: Min. 95%

Molecular weight: 265.11 g/mol

Ref: 3D-KZB44166