CAS 1235441-69-6

1-[4-[(Difluoromethyl)sulfonyl]-3-methoxyphenyl]ethanone

Description:

1-[4-[(Difluoromethyl)sulfonyl]-3-methoxyphenyl]ethanone, identified by its CAS number 1235441-69-6, is a synthetic organic compound characterized by its unique functional groups and structural features. This compound contains a ketone functional group, indicated by the ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of a difluoromethylsulfonyl group enhances its electrophilic properties, making it a valuable intermediate in medicinal chemistry and agrochemical development. The methoxy group attached to the phenyl ring can influence the compound's solubility and biological activity. Overall, this compound's distinctive structure suggests potential utility in various chemical reactions, including nucleophilic substitutions and coupling reactions, while its specific characteristics may also allow for targeted applications in pharmaceuticals or materials science. As with many synthetic compounds, understanding its stability, reactivity, and interaction with biological systems is crucial for assessing its practical applications.

Formula: C₁₀H₁₀F₂O₄S

InChI: InChI=1S/C10H10F2O4S/c1-6(13)7-3-4-9(8(5-7)16-2)17(14,15)10(11)12/h3-5,10H,1-2H3

InChI key: InChIKey=ZKDJXUXDVGZLKH-UHFFFAOYSA-N

SMILES: S(C(F)F)(=O)(=O)C1=C(OC)C=C(C(C)=O)C=C1

Synonyms:

• 1-[4-[(Difluoromethyl)sulfonyl]-3-methoxyphenyl]ethanone
• Ethanone, 1-[4-[(difluoromethyl)sulfonyl]-3-methoxyphenyl]-

1-(4-Difluoromethanesulfonyl-3-methoxyphenyl)ethan-1-one

CAS: 1235441-69-6

Versatile small molecule scaffold

Formula: C₁₀H₁₀F₂O₄S

Purity: Min. 95%

Molecular weight: 264.25 g/mol

Ref: 3D-KZB44169