CAS 1235441-77-6

Methyl 2-[3-(3-chloropropyl)-4-oxo-2-thiazolidinylidene]acetate

Description:

Methyl 2-[3-(3-chloropropyl)-4-oxo-2-thiazolidinylidene]acetate is a chemical compound characterized by its thiazolidine ring structure, which incorporates a carbonyl group and a chloropropyl substituent. This compound features a methyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the thiazolidine moiety suggests potential biological activity, as thiazolidines are often explored for their pharmacological properties. The chloropropyl group may enhance lipophilicity, influencing the compound's solubility and interaction with biological membranes. Additionally, the compound's structure indicates it may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic applications.

Formula: C₉H₁₂ClNO₃S

InChI: InChI=1S/C9H12ClNO3S/c1-14-9(13)5-8-11(4-2-3-10)7(12)6-15-8/h5H,2-4,6H2,1H3

InChI key: InChIKey=NRNCTEBQWRTURH-UHFFFAOYSA-N

SMILES: C(C(OC)=O)=C1N(CCCCl)C(=O)CS1

Synonyms:

• Methyl 2-[3-(3-chloropropyl)-4-oxo-2-thiazolidinylidene]acetate
• Acetic acid, 2-[3-(3-chloropropyl)-4-oxo-2-thiazolidinylidene]-, methyl ester

Methyl 2-[3-(3-chloropropyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate

CAS: 1235441-77-6

Versatile small molecule scaffold

Formula: C₉H₁₂ClNO₃S

Purity: Min. 95%

Molecular weight: 249.72 g/mol

Ref: 3D-KZB44177