CAS 1235568-21-4

3-[(1R,2R)-2-(Aminomethyl)-1-hydroxycyclohexyl]phenol

Description:

3-[(1R,2R)-2-(Aminomethyl)-1-hydroxycyclohexyl]phenol, with the CAS number 1235568-21-4, is a chemical compound characterized by its complex structure that includes a phenolic group and a cyclohexyl moiety. This compound features an aminomethyl group attached to a cyclohexanol derivative, which contributes to its potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements that can affect the compound's pharmacological properties, including receptor binding and activity. Such compounds are often studied for their potential therapeutic applications, particularly in fields like medicinal chemistry and pharmacology. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds are influenced by its functional groups, making it a subject of interest in various chemical and biological research contexts.

Formula: C₁₃H₁₉NO₂

InChI: InChI=1S/C13H19NO2/c14-9-11-4-1-2-7-13(11,16)10-5-3-6-12(15)8-10/h3,5-6,8,11,15-16H,1-2,4,7,9,14H2/t11-,13+/m1/s1

InChI key: InChIKey=MJTYLDGVLFSXDG-YPMHNXCESA-N

SMILES: O[C@]1([C@@H](CN)CCCC1)C2=CC(O)=CC=C2

Synonyms:

• 3-[(1R,2R)-2-(Aminomethyl)-1-hydroxycyclohexyl]phenol
• Phenol, 3-[(1R,2R)-2-(aminomethyl)-1-hydroxycyclohexyl]-
• 3-[(1S,2S)-2-(AMinoMethyl)-1-hydroxycyclohexyl]phenol
• (-)-O-DESMETHYL-N,N-BISDESMETHYLTRAMADOL

(+)-O-Desmethyl-N,N-bisdesmethyl Tramadol

CAS: 1235568-21-4

Applications A optically active metabolite of Tramadol.
References Lintz, V.W., et al.: Arzneim.-Forsch./Drug Res., 31, II, 11, 1932 (1981)

Formula: C₁₃H₁₉NO₂

Color and Shape: Neat

Molecular weight: 221.30

Ref: TR-D291155

(+)-o-Desmethyl-N,N-bisdesmethyl tramadol

CAS: 1235568-21-4

(+)-o-Desmethyl-N,N-bisdesmethyl tramadol is a synthetic opioid analgesic. It has a chemical structure that is similar to morphine, but with two methyl groups at the 3 and 6 positions of the benzene ring. (+)-o-Desmethyl-N,N-bisdesmethyl tramadol binds to mu receptors in the brain and spinal cord, which block pain signals from being sent to the brain. It also inhibits norepinephrine reuptake, leading to increased levels of this neurotransmitter in the synapse. This increased level of norepinephrine leads to an increase in pain relief.

Formula: C₁₃H₁₉NO₂

Purity: Min. 95%

Molecular weight: 221.29 g/mol

Ref: 3D-KZB56821