CAS 123557-49-3
:BIS-(2,2,5,5-TETRAMETHYL-3-IMIDAZOLINE-1-OXYL-4-YL)DISULFIDE
Description:
BIS-(2,2,5,5-TETRAMETHYL-3-IMIDAZOLINE-1-OXYL-4-YL)DISULFIDE, commonly referred to as a disulfide derivative of a stable nitroxide radical, is characterized by its unique structure that includes two imidazoline rings connected by a disulfide bond. This compound exhibits properties typical of nitroxides, such as stability under ambient conditions and the ability to act as a radical scavenger. It is often utilized in various applications, including as a spin label in electron paramagnetic resonance (EPR) spectroscopy and as an antioxidant in polymer chemistry. The presence of the disulfide linkage enhances its reactivity and potential for forming cross-links in polymer matrices. Additionally, the bulky tetramethyl groups contribute to its steric hindrance, influencing its solubility and interaction with other molecules. Overall, this compound is of interest in both academic research and industrial applications due to its unique radical properties and potential utility in materials science.
Formula:C14H26N4O2S2
InChI:InChI=1/C14H26N4O2S2/c1-11(2)9(15-13(5,6)17(11)19)21-22-10-12(3,4)18(20)14(7,8)16-10/h19-20H,1-8H3
SMILES:CC1(C)C(=NC(C)(C)N1O)SSC1=NC(C)(C)N(C1(C)C)O
Synonyms:- Rssr
- Bis-(2,2,5,5-tetramethyl-3-imidazoline-1-oxyl-4-yl) disulfide, free radical.
- 4,4'-disulfanediylbis(2,2,5,5-tetramethyl-2,5-dihydro-1H-imidazol-1-ol)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,4'-Dithiobis[2,5-dihydro-2,2,5,5-tetramethyl-1H-imidazol-1-yloxy] Bis Radical
CAS:Controlled ProductFormula:C14H24N4O2S2Color and Shape:NeatMolecular weight:344.496
