CymitQuimica logo

CAS 123572-59-8

:

2,4-difluoro-5-(trifluoromethoxy)aniline

Description:
2,4-Difluoro-5-(trifluoromethoxy)aniline is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two fluorine atoms and a trifluoromethoxy group. The presence of the difluoro and trifluoromethoxy substituents significantly influences its chemical properties, including increased lipophilicity and potential reactivity in electrophilic aromatic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its fluorinated groups contribute to unique physical properties, such as enhanced thermal stability and altered electronic characteristics, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential for hydrogen bonding due to the amine group, which can affect its interactions in biological systems. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2,4-difluoro-5-(trifluoromethoxy)aniline is a notable compound in the field of synthetic chemistry and materials science.
Formula:C7H4F5NO
InChI:InChI=1/C7H4F5NO/c8-3-1-4(9)6(2-5(3)13)14-7(10,11)12/h1-2H,13H2
InChI key:YDLIEJPIFDOQSD-UHFFFAOYSA-N
SMILES:c1c(c(cc(c1F)OC(F)(F)F)N)F
Found 4 products.