CAS 123594-64-9
:S-(+)-pd 128,907 hydrochloride
Description:
S-(+)-PD 128,907 hydrochloride, with the CAS number 123594-64-9, is a chemical compound that belongs to the class of selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential therapeutic effects in treating various psychiatric disorders, particularly depression and anxiety. The compound exhibits a chiral structure, with the "S-(+)" designation indicating its specific enantiomeric form, which is often associated with enhanced pharmacological activity compared to its counterpart. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in pharmaceutical formulations. The mechanism of action involves the inhibition of serotonin reuptake, leading to increased serotonin levels in the synaptic cleft, which is crucial for mood regulation. Additionally, S-(+)-PD 128,907 hydrochloride may have a favorable side effect profile compared to other SSRIs, making it a subject of interest in clinical research. However, as with all medications, its use should be guided by healthcare professionals, considering potential side effects and interactions with other drugs.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c1-2-5-15-6-7-17-14-11-8-10(16)3-4-13(11)18-9-12(14)15/h3-4,8,12,14,16H,2,5-7,9H2,1H3/t12-,14-/s2
InChI key:InChIKey=YOILXOMTHPUMRG-QSKWDSTQNA-N
SMILES:C(CC)N1[C@@]2([C@](C=3C(OC2)=CC=C(O)C3)(OCC1)[H])[H]
Synonyms:- (4aS,10bS)-4-propyl-3,4,4a,10b-tetrahydro-2H,5H-chromeno[4,3-b][1,4]oxazin-9-ol
- 2H,5H-(1)Benzopyrano(4,3-b)-1,4-oxazin-9-ol, 3,4,4a,10b-tetrahydro-4-propyl-, (4aR,10bR)-rel-
- 2H,5H-(1)Benzopyrano(4,3-b)-1,4-oxazin-9-ol, 3,4,4a,10b-tetrahydro-4-propyl-, trans-(+-)-
- 3,4,4a,10b-Tetrahydro-4-propyl-2H,5H-(1)benzopyrano(4,3-b)-1,4-oxazin-9-ol
- 4-propyl-3,4,4a,10b-tetrahydro-2H,5H-chromeno[4,3-b][1,4]oxazin-9-ol
- Pbpo
- Pbto
- Pd 128907
- Pd128907
- rel-(4aR,10bR)-3,4,4a,10b-Tetrahydro-4-propyl-2H,5H-[1]benzopyrano[4,3-b]-1,4-oxazin-9-ol
- trans-(+-)-3,4,4a,10b-Tetrahydro-4-propyl-2H,5H-(1)benzopyrano(4,3-b)-1,4-oxazin-9-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pd 128907
CAS:Pd 128907 is a selective agonist that targets the A2A adenosine receptor, which is a G protein-coupled receptor critical in numerous physiological processes. This compound is originally synthesized through a chemical synthesis process that involves precise structural engineering to ensure specificity to the A2A receptor subtype. Its mode of action involves binding to the receptor and mimicking the effects of adenosine, which results in modulation of downstream signaling pathways.Formula:C14H19NO3Purity:Min. 95%Molecular weight:249.3 g/molPD 128907
CAS:PD 128907 - potent, selective dopamine D2/D3 agonist for researching receptor roles in the brain.Formula:C14H19NO3Purity:98%Color and Shape:SolidMolecular weight:249.31


