CAS 123606-23-5

N-1-(fur-3-ylethyl)-N-hydroxyurea

Description:

N-1-(fur-3-ylethyl)-N-hydroxyurea is a chemical compound characterized by its unique structure, which includes a hydroxyurea moiety and a furyl group. This compound typically exhibits properties associated with both the hydroxyurea and furan functional groups, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the hydroxy group. The furan ring contributes to its aromaticity and may influence its reactivity and stability. N-1-(fur-3-ylethyl)-N-hydroxyurea is of interest in medicinal chemistry, particularly for its potential biological activities, including antitumor properties. The compound's specific interactions with biological targets can vary, making it a subject of research in drug development. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology.

Formula: C₇H₁₀N₂O₃

InChI: InChI=1/C7H10N2O3/c1-5(9(11)7(8)10)6-2-3-12-4-6/h2-5,11H,1H3,(H2,8,10)

SMILES: CC(c1ccoc1)N(C(=N)O)O

Synonyms:

• A 69412
• Urea, N-(1-(3-furanyl)ethyl)-N-hydroxy-
• 1-[1-(Furan-3-Yl)Ethyl]-1-Hydroxyurea

UREA, N-[1-(3-FURANYL)ETHYL]-N-HYDROXY-

CAS: 123606-23-5

Formula: C₇H₁₀N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.1659

Ref: IN-DA000KUX

A-69412

CAS: 123606-23-5

A-69412

Purity: ≥98%

Molecular weight: 170.17g/mol

Ref: 54-BUP12017

N-1-(Fur-3-ylethyl)-N-hydroxyurea

CAS: 123606-23-5

N-1-(Fur-3-ylethyl)-N-hydroxyurea is a chemical compound, which is a synthetic molecule designed for research and potential therapeutic applications. It is derived from organic synthetic processes involving urea and furanyl derivatives. The mode of action for N-1-(Fur-3-ylethyl)-N-hydroxyurea typically involves the inhibition of specific enzymatic activities, potentially through the formation of stable complexes with metal ions or disruption of enzyme-substrate interactions, although detailed mechanistic studies might be needed to fully elucidate its biochemical pathways.

Formula: C₇H₁₀N₂O₃

Purity: Min. 95%

Molecular weight: 170.17 g/mol

Ref: 3D-YEA60623

A-69412

CAS: 123606-23-5

A-69412 is a reversible 5-lipoxygenase inhibitor, potentially treating ulcerative colitis and asthma.

Formula: C₇H₁₀N₂O₃

Purity: 99.54%

Color and Shape: Solid

Molecular weight: 170.17

Ref: TM-T10208