
CAS 123612-50-0
:2-Butyl-1,2-dihydroquinoline
Description:
2-Butyl-1,2-dihydroquinoline is an organic compound characterized by its bicyclic structure, which includes a quinoline moiety with a butyl substituent. This compound features a fused ring system consisting of a benzene ring and a pyridine ring, contributing to its aromatic properties. The presence of the butyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, 2-butyl-1,2-dihydroquinoline exhibits moderate stability under standard conditions, but it may undergo various chemical reactions, such as oxidation or electrophilic substitution, due to the presence of the nitrogen atom in the ring. This compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals and as a building block for more complex molecules. Additionally, its unique structure may impart specific biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H17N
InChI:InChI=1S/C13H17N/c1-2-3-7-12-10-9-11-6-4-5-8-13(11)14-12/h4-6,8-10,12,14H,2-3,7H2,1H3
InChI key:InChIKey=KQRMRAPLFTXHFF-UHFFFAOYSA-N
SMILES:C(CCC)C1NC=2C(C=C1)=CC=CC2
Synonyms:- 2-n-Butyl-1,2-dihydroquinoline
- Quinoline, 2-butyl-1,2-dihydro-
- 2-Butyl-1,2-dihydroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
