CAS 1236254-65-1

Methanone, (hexahydro-1H-azepin-1-yl)-2-pyrrolidinyl-, hydrochloride (1:1)

Description:

Methanone, (hexahydro-1H-azepin-1-yl)-2-pyrrolidinyl-, hydrochloride (1:1), identified by CAS number 1236254-65-1, is a chemical compound that features a complex structure involving a methanone functional group and a combination of azepine and pyrrolidine rings. This compound is typically characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its pharmacological properties. The presence of the hexahydro-1H-azepin-1-yl moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The hydrochloride form indicates that it is likely to be a stable, crystalline solid at room temperature, with potential uses in various chemical syntheses or as an intermediate in drug development. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the precise molecular interactions and the environment in which it is used. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₂₀N₂O·ClH

InChI: InChI=1S/C11H20N2O.ClH/c14-11(10-6-5-7-12-10)13-8-3-1-2-4-9-13;/h10,12H,1-9H2;1H

InChI key: InChIKey=XZUGTPHYTVKAPX-UHFFFAOYSA-N

SMILES: C(=O)(C1CCCN1)N2CCCCCC2.Cl

Synonyms:

• Methanone, (hexahydro-1H-azepin-1-yl)-2-pyrrolidinyl-, hydrochloride (1:1)

1-Azepanyl(2-pyrrolidinyl)methanone hydrochloride

CAS: 1236254-65-1

Versatile small molecule scaffold

Formula: C₁₁H₂₁ClN₂O

Purity: Min. 95%

Molecular weight: 232.75 g/mol

Ref: 3D-LZB25465