CAS 1236254-69-5

2-Pyrrolidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyrrolidine ring, which contributes to its cyclic structure. The presence of the N-(3-hydroxybutyl) substituent indicates that it has a hydroxybutyl group attached to the nitrogen atom of the pyrrolidine, enhancing its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand or modulator in biological systems, although specific biological activities would depend on further studies. Its molecular structure suggests it may participate in hydrogen bonding due to the presence of both the amide and hydroxyl groups, influencing its interactions in biological environments. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields.

Formula: C₉H₁₈N₂O₂·ClH

InChI: InChI=1S/C9H18N2O2.ClH/c1-7(12)4-6-11-9(13)8-3-2-5-10-8;/h7-8,10,12H,2-6H2,1H3,(H,11,13);1H

InChI key: InChIKey=HCZKCYUJUIXBNG-UHFFFAOYSA-N

SMILES: C(NCCC(C)O)(=O)C1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1)