CAS 1236254-91-3

1-Propanone, 2-amino-1-[4-(2-hydroxyethyl)-1-piperazinyl]-3-phenyl-, hydrochloride (1:1)

Description:

1-Propanone, 2-amino-1-[4-(2-hydroxyethyl)-1-piperazinyl]-3-phenyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its complex structure that includes a propanone backbone, an amino group, and a piperazine moiety with a hydroxyethyl substituent. This compound typically exhibits properties associated with both amines and ketones, such as potential solubility in polar solvents due to the presence of the hydroxyl and amino groups. The hydrochloride form enhances its stability and solubility in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperazine ring suggests potential biological activity, often linked to central nervous system effects or interactions with neurotransmitter systems. As with many organic compounds, its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₅H₂₃N₃O₂·ClH

InChI: InChI=1S/C15H23N3O2.ClH/c16-14(12-13-4-2-1-3-5-13)15(20)18-8-6-17(7-9-18)10-11-19;/h1-5,14,19H,6-12,16H2;1H

InChI key: InChIKey=QUDHRXFTTQHNJE-UHFFFAOYSA-N

SMILES: C(C(CC1=CC=CC=C1)N)(=O)N2CCN(CCO)CC2.Cl

Synonyms:

• 1-Propanone, 2-amino-1-[4-(2-hydroxyethyl)-1-piperazinyl]-3-phenyl-, hydrochloride (1:1)